5'-O-(4,4'-Dimethoxytrityl)-N6-Phenoxyacetyl adenosine structure
|
Common Name | 5'-O-(4,4'-Dimethoxytrityl)-N6-Phenoxyacetyl adenosine | ||
|---|---|---|---|---|
| CAS Number | 121076-16-2 | Molecular Weight | 703.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H37N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-O-(4,4'-Dimethoxytrityl)-N6-Phenoxyacetyl adenosine5’-O-(4,4’-Dimethoxytrityl)-N6-phenoxyacetyl adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 5'-O-dimethoxytrityl-N6-phenoxyacetyladenosine |
|---|---|
| Synonym | More Synonyms |
| Description | 5’-O-(4,4’-Dimethoxytrityl)-N6-phenoxyacetyl adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C39H37N5O8 |
|---|---|
| Molecular Weight | 703.74 |
| Exact Mass | 703.26400 |
| PSA | 159.31000 |
| LogP | 4.56190 |
| InChIKey | GWFRSQBGIGLMFD-BBKOCAQVSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(NC(=O)COc5ccccc5)ncnc43)C(O)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Adenosine,5'-O-[bis(4-methoxyphenyl)phenylmethyl]-N-(phenoxyacetyl)- |