(2,2-dichloro-3-hydroxy-3-phenyl-propyl) carbamate structure
|
Common Name | (2,2-dichloro-3-hydroxy-3-phenyl-propyl) carbamate | ||
|---|---|---|---|---|
| CAS Number | 1211-00-3 | Molecular Weight | 264.10500 | |
| Density | 1.439g/cm3 | Boiling Point | 470.5ºC at 760mmHg | |
| Molecular Formula | C10H11Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.3ºC | |
| Name | (2,2-dichloro-3-hydroxy-3-phenylpropyl) carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 470.5ºC at 760mmHg |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.10500 |
| Flash Point | 238.3ºC |
| Exact Mass | 263.01200 |
| PSA | 73.54000 |
| LogP | 2.50300 |
| Vapour Pressure | 1.18E-09mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | KIUGWPDQHKXJHE-UHFFFAOYSA-N |
| SMILES | NC(=O)OCC(Cl)(Cl)C(O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamidsaeure-(2,2-dichlor-3-hydroxy-3-phenyl-propylester) |
| 2,2-Dichloro-1-phenyl-1,3-propanediol 3-carbamate |
| carbamic acid-(2,2-dichloro-3-hydroxy-3-phenyl-propyl ester) |
| SQ 4909 |