1,3-Bis(di-tert-butylphosphino)propane structure
|
Common Name | 1,3-Bis(di-tert-butylphosphino)propane | ||
|---|---|---|---|---|
| CAS Number | 121115-33-1 | Molecular Weight | 332.484 | |
| Density | N/A | Boiling Point | 379.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C19H42P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8±29.5 °C | |
| Name | ditert-butyl(3-ditert-butylphosphanylpropyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 379.2±25.0 °C at 760 mmHg |
|---|---|
| Molecular Formula | C19H42P2 |
| Molecular Weight | 332.484 |
| Flash Point | 192.8±29.5 °C |
| Exact Mass | 332.276184 |
| PSA | 27.18000 |
| LogP | 6.86 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| InChIKey | FJILYPCZXWVDMD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(CCCP(C(C)(C)C)C(C)(C)C)C(C)(C)C |
|
~63%
1,3-Bis(di-tert... CAS#:121115-33-1 |
| Literature: Morris, David J.; Docherty, Gordon; Woodward, Gary; Wills, Martin Tetrahedron Letters, 2007 , vol. 48, # 6 p. 949 - 953 |
|
~%
1,3-Bis(di-tert... CAS#:121115-33-1 |
| Literature: Carr, Nicholas; Dunne, Barry J.; Mole, Laura; Orpen, A. Guy; Spencer, John L. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1991 , # 4 p. 863 - 871 |
| 1,3-Propanediylbis[bis(2-methyl-2-propanyl)phosphine] |
| Di(tert-butyl)(3-[di(tert-butyl)phosphino]propyl)phosphine |
| Phosphine, 1,1'-(1,3-propanediyl)bis[1,1-bis(1,1-dimethylethyl)- |
| Phosphine, 1,3-propanediylbis[bis(1,1-dimethylethyl)- |
| 1,3-Bis(di-tert-butylphosphino)propane |