1-BOC-6-METHYL-1,4-DIAZEPANE structure
|
Common Name | 1-BOC-6-METHYL-1,4-DIAZEPANE | ||
|---|---|---|---|---|
| CAS Number | 1211595-59-3 | Molecular Weight | 214.305 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 288.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C11H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.2±22.6 °C | |
| Name | tert-butyl 6-methyl-1,4-diazepane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.3±23.0 °C at 760 mmHg |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.305 |
| Flash Point | 128.2±22.6 °C |
| Exact Mass | 214.168121 |
| PSA | 41.57000 |
| LogP | 1.43 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | KPOYZVQMOOKKQV-UHFFFAOYSA-N |
| SMILES | CC1CNCCN(C(=O)OC(C)(C)C)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-1,4-Diazepine-1-carboxylic acid, hexahydro-6-methyl-, 1,1-dimethylethyl ester |
| 1-Boc-6-Methyl-1,4-diazepane |
| 2-Methyl-2-propanyl 6-methyl-1,4-diazepane-1-carboxylate |
| 1-Boc-6-Methyl-1,4-diazepane-1-carboxylate |
| Hexahydro-6-methyl-1H-1,4-Diazepine-1-carboxylic Acid 1,1-Dimethylethyl Ester |
| 6-Methyl-[1,4]diazepane-1-carboxylic acid tert-butyl ester |