2-[(4-hydroxy-3-methoxybenzoyl)amino]acetic acid structure
|
Common Name | 2-[(4-hydroxy-3-methoxybenzoyl)amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1212-04-0 | Molecular Weight | 225.19800 | |
| Density | 1.378g/cm3 | Boiling Point | 470.9ºC at 760mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.6ºC | |
| Name | 2-[(4-hydroxy-3-methoxybenzoyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 470.9ºC at 760mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 238.6ºC |
| Exact Mass | 225.06400 |
| PSA | 99.35000 |
| LogP | 0.79000 |
| Vapour Pressure | 1.14E-09mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | LOODYTDRRBLQNH-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)NCC(=O)O)ccc1O |
| HS Code | 2924299090 |
|---|
|
~%
2-[(4-hydroxy-3... CAS#:1212-04-0 |
| Literature: Fischer,E.; Freudenberg Justus Liebigs Annalen der Chemie, 1910 , vol. 372, p. 36 |
|
~%
2-[(4-hydroxy-3... CAS#:1212-04-0 |
| Literature: Fischer,E.; Freudenberg Justus Liebigs Annalen der Chemie, 1910 , vol. 372, p. 36 |
|
~%
2-[(4-hydroxy-3... CAS#:1212-04-0 |
| Literature: Fischer,E.; Freudenberg Justus Liebigs Annalen der Chemie, 1910 , vol. 372, p. 36 |
|
~%
2-[(4-hydroxy-3... CAS#:1212-04-0 |
| Literature: Fischer,E.; Freudenberg Justus Liebigs Annalen der Chemie, 1910 , vol. 372, p. 36 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Glycine,N-(4-hydroxy-3-methoxybenzoyl) |
| 3-Methoxy-4-hydroxyhippuric acid |
| 4-Oxy-3-methoxy-benzaminoessigsaeure |
| Vanilloylglycine |
| 4-Oxy-3-methoxy-hippursaeure |
| N-Vanilloyl-glycin |
| N-vanilloyl-glycine |