Fmoc-L-Cyclopropylglycine structure
|
Common Name | Fmoc-L-Cyclopropylglycine | ||
|---|---|---|---|---|
| CAS Number | 1212257-18-5 | Molecular Weight | 337.369 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 577.1±33.0 °C at 760 mmHg | |
| Molecular Formula | C20H19NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 302.8±25.4 °C | |
| Name | (2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 577.1±33.0 °C at 760 mmHg |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.369 |
| Flash Point | 302.8±25.4 °C |
| Exact Mass | 337.131409 |
| PSA | 79.12000 |
| LogP | 3.91 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | YMLZBPTXRMNAFP-SFHVURJKSA-N |
| SMILES | O=C(NC(C(=O)O)C1CC1)OCC1c2ccccc2-c2ccccc21 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2S)-Cyclopropyl{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}acetic acid |
| OR2679 |
| Cyclopropaneacetic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (αS)- |
| L-Cyclopropylglycine,N-FMOC protected |
| Fmoc-L-Cyclopropylglycine |
| FL572-1 |
| (2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)aceticacid |