3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate
Modify Date: 2026-09-28 20:39:56
3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate structure
|
Common Name | 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 121237-93-2 | Molecular Weight | 632.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H52O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C35H52O10 |
|---|---|
| Molecular Weight | 632.8 |
| InChIKey | XFMSVFNINMGOKO-ZNZGTKMOSA-N |
| SMILES | CCCCCCCc1cc(OC)cc(OC(=O)c2c(CCCCCCC)cc(OC)cc2OC2OC(C(O)CO)C(O)C2O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate? |
| A: InChIKey of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate is XFMSVFNINMGOKO-ZNZGTKMOSA-N. |
| Q: What is the molecular weight of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate? |
| A: Molecular weight of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate is 632.8. |
| Q: What is the CAS number of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate? |
| A: CAS number of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate is 121237-93-2. |
| Q: What is the molecular formula of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate? |
| A: Molecular formula of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate is C35H52O10. |
| Q: What is the SMILES notation of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate? |
| A: SMILES notation of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate is CCCCCCCc1cc(OC)cc(OC(=O)c2c(CCCCCCC)cc(OC)cc2OC2OC(C(O)CO)C(O)C2O)c1. |
| Q: What is the Chinese name of 121237-93-2? |
| A: Chinese name of 121237-93-2 is 121237-93-2. |
| Q: What is the English name of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate? |
| A: The English name of 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate is 3-Heptyl-5-methoxyphenyl 2-(I(2)-D-galactofuranosyloxy)-6-heptyl-4-methoxybenzoate. |