Pyridine,3,5-dibromo-4-nitro- structure
|
Common Name | Pyridine,3,5-dibromo-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 121263-11-4 | Molecular Weight | 281.89000 | |
| Density | 2.221g/cm3 | Boiling Point | 241ºC at 760mmHg | |
| Molecular Formula | C5H2Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.5ºC | |
| Name | 3,5-dibromo-4-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.221g/cm3 |
|---|---|
| Boiling Point | 241ºC at 760mmHg |
| Molecular Formula | C5H2Br2N2O2 |
| Molecular Weight | 281.89000 |
| Flash Point | 99.5ºC |
| Exact Mass | 279.84800 |
| PSA | 58.71000 |
| LogP | 3.03800 |
| Vapour Pressure | 0.0572mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | VHJGZEKSOAMLMD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Br)cncc1Br |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine,3,5-dibromo-4-nitro |
| 4-Nitro-3,5-dibromopyridine |