(1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol
Modify Date: 2025-09-10 09:14:54
(1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol structure
|
Common Name | (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol | ||
|---|---|---|---|---|
| CAS Number | 1212986-82-7 | Molecular Weight | 241.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO4 |
|---|---|
| Molecular Weight | 241.28 |
| InChIKey | KEUQYTQCKJAYBE-NXEZZACHSA-N |
| SMILES | COc1ccc(C(O)CC(N)CO)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol? |
| A: The English name of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol is (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol. |
| Q: What is the InChIKey of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol? |
| A: InChIKey of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol is KEUQYTQCKJAYBE-NXEZZACHSA-N. |
| Q: What is the CAS number of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol? |
| A: CAS number of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol is 1212986-82-7. |
| Q: What is the molecular weight of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol? |
| A: Molecular weight of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol is 241.28. |
| Q: What is the SMILES notation of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol? |
| A: SMILES notation of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol is COc1ccc(C(O)CC(N)CO)cc1OC. |
| Q: What is the Chinese name of 1212986-82-7? |
| A: Chinese name of 1212986-82-7 is 1212986-82-7. |
| Q: What is the molecular formula of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol? |
| A: Molecular formula of (1R,3R)-3-Amino-1-(3,4-dimethoxyphenyl)-1,4-butanediol is C12H19NO4. |