3,9-bis(prop-1-en-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecane structure
|
Common Name | 3,9-bis(prop-1-en-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecane | ||
|---|---|---|---|---|
| CAS Number | 1213-20-3 | Molecular Weight | 240.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,9-bis(prop-1-en-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20O4 |
|---|---|
| Molecular Weight | 240.29500 |
| Exact Mass | 240.13600 |
| PSA | 36.92000 |
| LogP | 1.87080 |
| InChIKey | LBYBPYLNIKBWEP-UHFFFAOYSA-N |
| SMILES | C=C(C)C1OCC2(CO1)COC(C(=C)C)OC2 |
| HS Code | 2932999099 |
|---|
|
~%
3,9-bis(prop-1-... CAS#:1213-20-3 |
| Literature: Brown et al. Journal of Chemical and Engineering Data, 1959 , vol. 4, p. 182,183 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Dimethallidenpentaerythritol |
| 2,4,8,10-Tetraoxaspiro[5.5]undecane,3,9-bis(1-methylethenyl) |
| Di-methallyliden-pentaerythritol |
| Dimethallylidenpentaerythrol |
| 3,9-diisopropenyl-2,4,8,10-tetraoxa-spiro[5.5]undecane |