(R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate
Modify Date: 2025-08-28 13:57:11
(R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate structure
|
Common Name | (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 1213143-20-4 | Molecular Weight | 213.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12FNO3 |
|---|---|
| Molecular Weight | 213.21 |
| InChIKey | VNYAAQYTKQTBGC-SECBINFHSA-N |
| SMILES | COC(=O)C(N)Cc1ccc(O)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate? |
| A: The English name of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate is (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate. |
| Q: What is the Chinese name of 1213143-20-4? |
| A: Chinese name of 1213143-20-4 is 1213143-20-4. |
| Q: What is the molecular weight of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate? |
| A: Molecular weight of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate is 213.21. |
| Q: What is the SMILES notation of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate? |
| A: SMILES notation of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate is COC(=O)C(N)Cc1ccc(O)cc1F. |
| Q: What is the CAS number of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate? |
| A: CAS number of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate is 1213143-20-4. |
| Q: What is the molecular formula of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate? |
| A: Molecular formula of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate is C10H12FNO3. |
| Q: What is the InChIKey of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate? |
| A: InChIKey of (R)-Methyl 2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoate is VNYAAQYTKQTBGC-SECBINFHSA-N. |