4-[2-(4-carbamimidoylphenoxy)ethoxy]benzenecarboximidamide structure
|
Common Name | 4-[2-(4-carbamimidoylphenoxy)ethoxy]benzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 121324-47-8 | Molecular Weight | 298.34000 | |
| Density | 1.27g/cm3 | Boiling Point | 504.1ºC at 760mmHg | |
| Molecular Formula | C16H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.7ºC | |
| Name | 4-[2-(4-carbamimidoylphenoxy)ethoxy]benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 504.1ºC at 760mmHg |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.34000 |
| Flash Point | 258.7ºC |
| Exact Mass | 298.14300 |
| PSA | 118.20000 |
| LogP | 3.31260 |
| Vapour Pressure | 2.73E-10mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | PWLGDGGFMJVYHP-UHFFFAOYSA-N |
| SMILES | N=C(N)c1ccc(OCCOc2ccc(C(=N)N)cc2)cc1 |
|
~%
4-[2-(4-carbami... CAS#:121324-47-8 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
|
~%
4-[2-(4-carbami... CAS#:121324-47-8 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
|
~%
4-[2-(4-carbami... CAS#:121324-47-8 |
| Literature: Oxley; Short Journal of the Chemical Society, 1946 , p. 147,149 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,4'-(1,2-Ethanediylbis(oxy))bis-benzenecarboximidamide |
| 1.2-Bis-(4-carbamimidoyl-phenoxy)-aethan |
| 4,4'-Aethandiyldioxy-bis-benzamidin |
| 4.4'-Aethylendioxy-bis-benzamidin |
| 1,2-Di(4-amidinophenoxy)ethane |
| 4,4'-ethanediyldioxy-bis-benzamidine |
| 1,2-Bis-(4-guanylphenoxy)ethan |