Rubellin C structure
|
Common Name | Rubellin C | ||
|---|---|---|---|---|
| CAS Number | 121325-48-2 | Molecular Weight | 526.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H22O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Rubellin C |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H22O9 |
|---|---|
| Molecular Weight | 526.5 |
| InChIKey | FWHRHQWEGRLEBF-QKXMQONGSA-N |
| SMILES | Cc1cc(O)c2c(c1)C(C13Cc4cc(O)c5c(c4C1C=CC(O)C3O)C(=O)c1cccc(O)c1C5=O)OC2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 121325-48-2? |
| A: Chinese name of 121325-48-2 is 121325-48-2. |
| Q: What is the InChIKey of Rubellin C? |
| A: InChIKey of Rubellin C is FWHRHQWEGRLEBF-QKXMQONGSA-N. |
| Q: What is the molecular formula of Rubellin C? |
| A: Molecular formula of Rubellin C is C30H22O9. |
| Q: What is the English name of Rubellin C? |
| A: The English name of Rubellin C is Rubellin C. |
| Q: What is the molecular weight of Rubellin C? |
| A: Molecular weight of Rubellin C is 526.5. |
| Q: What is the CAS number of Rubellin C? |
| A: CAS number of Rubellin C is 121325-48-2. |
| Q: What is the SMILES notation of Rubellin C? |
| A: SMILES notation of Rubellin C is Cc1cc(O)c2c(c1)C(C13Cc4cc(O)c5c(c4C1C=CC(O)C3O)C(=O)c1cccc(O)c1C5=O)OC2=O. |