Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate
Modify Date: 2026-07-12 09:19:24
Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate structure
|
Common Name | Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 1213441-82-7 | Molecular Weight | 266.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10Cl2FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10Cl2FNO2 |
|---|---|
| Molecular Weight | 266.09 |
| InChIKey | JXPWERRLCCWGKE-MRVPVSSYSA-N |
| SMILES | COC(=O)C(N)Cc1cc(Cl)cc(Cl)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate? |
| A: The English name of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate is Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate. |
| Q: What is the SMILES notation of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate? |
| A: SMILES notation of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate is COC(=O)C(N)Cc1cc(Cl)cc(Cl)c1F. |
| Q: What is the Chinese name of 1213441-82-7? |
| A: Chinese name of 1213441-82-7 is 1213441-82-7. |
| Q: What is the CAS number of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate? |
| A: CAS number of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate is 1213441-82-7. |
| Q: What is the InChIKey of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate? |
| A: InChIKey of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate is JXPWERRLCCWGKE-MRVPVSSYSA-N. |
| Q: What is the molecular weight of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate? |
| A: Molecular weight of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate is 266.09. |
| Q: What is the molecular formula of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate? |
| A: Molecular formula of Methyl (R)-2-amino-3-(3,5-dichloro-2-fluorophenyl)propanoate is C10H10Cl2FNO2. |