2-diethylamino-5-phenyl-2-oxazolin-4-one structure
|
Common Name | 2-diethylamino-5-phenyl-2-oxazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 1214-73-9 | Molecular Weight | 232.27800 | |
| Density | 1.14g/cm3 | Boiling Point | 326.7ºC at 760mmHg | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.4ºC | |
| Name | 2-(diethylamino)-5-phenyl-1,3-oxazol-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 326.7ºC at 760mmHg |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.27800 |
| Flash Point | 151.4ºC |
| Exact Mass | 232.12100 |
| PSA | 41.90000 |
| LogP | 1.41790 |
| Vapour Pressure | 0.000213mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | NLLUMJUXYNCDIS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC(=O)C(c2ccccc2)O1 |
| HS Code | 2934999090 |
|---|
|
~%
2-diethylamino-... CAS#:1214-73-9 |
| Literature: Journal of Organic Chemistry, , vol. 27, p. 1679 - 1685 |
|
~%
2-diethylamino-... CAS#:1214-73-9 |
| Literature: Journal of Organic Chemistry, , vol. 27, p. 1679 - 1685 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Diethylamino-5-phenyl-2-oxazolin-4-one |
| Tradon L |
| HA 94 |
| 2-(Diethylamino)-5-phenyl-4(5H)-oxazolone |
| 4(5H)-Oxazolone,2-(diethylamino)-5-phenyl |
| 2-Oxazolin-4-one,2-(diethylamino)-5-phenyl |
| 2-diethylamino-5-phenyl-oxazol-4-one |
| 2-Diethylamino-5-phenyloxazolinone-(4) |
| 5-Phenyl-2-diethylamino-2-oxazolin-4-on |