2,6-dimethylhept-4-en-3-yl ethyl carbonate structure
|
Common Name | 2,6-dimethylhept-4-en-3-yl ethyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 121440-82-2 | Molecular Weight | 214.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethylhept-4-en-3-yl ethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H22O3 |
|---|---|
| Molecular Weight | 214.30100 |
| Exact Mass | 214.15700 |
| PSA | 35.53000 |
| LogP | 3.39630 |
| InChIKey | QQQOBWUTKMYEAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)OC(C=CC(C)C)C(C)C |
|
~78%
2,6-dimethylhep... CAS#:121440-82-2 |
| Literature: Hayashi, Tamio; Yamamoto, Akihiro; Ito, Yoshihiko; Nishioka, Eriko; Miura, Hitoshi; Yanagi, Kazunori Journal of the American Chemical Society, 1989 , vol. 111, # 16 p. 6301 - 6311 |
|
~%
2,6-dimethylhep... CAS#:121440-82-2 |
| Literature: Hayashi, Tamio; Yamamoto, Akihiro; Ito, Yoshihiko; Nishioka, Eriko; Miura, Hitoshi; Yanagi, Kazunori Journal of the American Chemical Society, 1989 , vol. 111, # 16 p. 6301 - 6311 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| [(E)-2,6-dimethylhept-4-en-3-yl] Ethyl Carbonate |
| ethyl rac-(E)-2,5-dimethylhept-4-en-3-yl carbonate |
| rac-(E)-ethyl-2,5-dimethyl-3-hex-4-enylcarbonate |
| rac-(E)-ethyl 2,6-dimethyl-3-hept-4-enylcarbonate |
| (E)-1-(1-methylethyl)-4-methyl-2-pentenyl ethyl carbonate |
| Carbonic acid,ethyl (2E)-4-methyl-1-(1-methylethyl)-2-pentenyl ester |