[(1R,4aR,5S,7R,8S,8aR)-5-acetyloxy-4a-(acetyloxymethyl)-8-[(2S)-2-acetyloxy-2-(5-oxo-2H-furan-3-yl)ethyl]-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-1-yl] (2S)-2-methylbutanoate structure
|
Common Name | [(1R,4aR,5S,7R,8S,8aR)-5-acetyloxy-4a-(acetyloxymethyl)-8-[(2S)-2-acetyloxy-2-(5-oxo-2H-furan-3-yl)ethyl]-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-1-yl] (2S)-2-methylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 121449-65-8 | Molecular Weight | 592.67400 | |
| Density | 1.23g/cm3 | Boiling Point | 660.2ºC at 760mmHg | |
| Molecular Formula | C31H44O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.3ºC | |
| Name | [(1R,4aR,5S,7R,8S,8aR)-5-acetyloxy-4a-(acetyloxymethyl)-8-[(2S)-2-acetyloxy-2-(5-oxo-2H-furan-3-yl)ethyl]-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-1-yl] (2S)-2-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 660.2ºC at 760mmHg |
| Molecular Formula | C31H44O11 |
| Molecular Weight | 592.67400 |
| Flash Point | 273.3ºC |
| Exact Mass | 592.28800 |
| PSA | 144.03000 |
| LogP | 3.45560 |
| Vapour Pressure | 2.64E-17mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | UNNFPBMLPYVEEM-PKLXYFJKSA-N |
| SMILES | CCC(C)C(=O)OC1CCC2(CO2)C2(COC(C)=O)C(OC(C)=O)CC(C)C(C)(CC(OC(C)=O)C3=CC(=O)OC3)C12 |
|
~%
[(1R,4aR,5S,7R,... CAS#:121449-65-8 |
| Literature: Shimomura, Hiroko; Sashida, Yutaka; Ogawa, Kazunori Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 2 p. 354 - 357 |
|
~%
[(1R,4aR,5S,7R,... CAS#:121449-65-8 |
| Literature: Shimomura, Hiroko; Sashida, Yutaka; Ogawa, Kazunori Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 4 p. 988 - 992 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ajugamarin B 1 |
| dihydroajugamarin |