4-(4-amino-3-methylphenyl)-2-methylaniline,2-methylphenol structure
|
Common Name | 4-(4-amino-3-methylphenyl)-2-methylaniline,2-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 121476-13-9 | Molecular Weight | 320.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-amino-3-methylphenyl)-2-methylaniline,2-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H24N2O |
|---|---|
| Molecular Weight | 320.42800 |
| Exact Mass | 320.18900 |
| PSA | 72.27000 |
| LogP | 5.99780 |
| InChIKey | LOAWCZVVIQTVPY-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccc(N)c(C)c2)ccc1N.Cc1ccccc1O |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3'-Dimethyl-[1,1'-biphenyl]-4,4'-diamine compound with o-cresol (1:1) |