2-[(3-Amino-2,4,6-triiodophenyl)methylene]butanoic acid structure
|
Common Name | 2-[(3-Amino-2,4,6-triiodophenyl)methylene]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1215-70-9 | Molecular Weight | 568.91600 | |
| Density | 2.513g/cm3 | Boiling Point | 550.1ºC at 760mmHg | |
| Molecular Formula | C11H10I3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.5ºC | |
| Name | (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.513g/cm3 |
|---|---|
| Boiling Point | 550.1ºC at 760mmHg |
| Molecular Formula | C11H10I3NO2 |
| Molecular Weight | 568.91600 |
| Flash Point | 286.5ºC |
| Exact Mass | 568.78500 |
| PSA | 63.32000 |
| LogP | 4.54180 |
| Vapour Pressure | 6.18E-13mmHg at 25°C |
| Index of Refraction | 1.788 |
| InChIKey | WRRIFEUVZSLRCF-HWKANZROSA-N |
| SMILES | CCC(=Cc1c(I)cc(I)c(N)c1I)C(=O)O |
| HS Code | 2922499990 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Cinamiodyl |