tert-butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate structure
|
Common Name | tert-butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1215071-17-2 | Molecular Weight | 235.228 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 274.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H15F2NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 120.0±27.3 °C | |
| Name | tert-butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 274.7±40.0 °C at 760 mmHg |
| Molecular Formula | C10H15F2NO3 |
| Molecular Weight | 235.228 |
| Flash Point | 120.0±27.3 °C |
| Exact Mass | 235.102005 |
| PSA | 46.61000 |
| LogP | 0.83 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | GDZBFUOJMJSIAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(F)(F)C1 |
| Water Solubility | Slightly soluble (8.9 g/L) (25 ºC) |
| HS Code | 2933399090 |
|---|
|
~%
tert-butyl 3,3-... CAS#:1215071-17-2 |
| Literature: WO2012/66488 A2, ; Page/Page column 63-64 ; WO 2012/066488 A2 |
|
~%
tert-butyl 3,3-... CAS#:1215071-17-2 |
| Literature: WO2012/66488 A2, ; WO 2012/066488 A2 |
|
~%
tert-butyl 3,3-... CAS#:1215071-17-2 |
| Literature: WO2012/66488 A2, ; WO 2012/066488 A2 |
|
~%
tert-butyl 3,3-... CAS#:1215071-17-2 |
| Literature: WO2012/66488 A2, ; WO 2012/066488 A2 |
|
~%
tert-butyl 3,3-... CAS#:1215071-17-2 |
| Literature: WO2012/66488 A2, ; WO 2012/066488 A2 |
|
~%
tert-butyl 3,3-... CAS#:1215071-17-2 |
| Literature: Tetrahedron Letters, , vol. 54, # 11 p. 1424 - 1427 |
|
~%
tert-butyl 3,3-... CAS#:1215071-17-2 |
| Literature: Tetrahedron Letters, , vol. 54, # 11 p. 1424 - 1427 |
|
~%
tert-butyl 3,3-... CAS#:1215071-17-2 |
| Literature: Tetrahedron Letters, , vol. 54, # 11 p. 1424 - 1427 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate hydrate |
| 2-Methyl-2-propanyl 3,3-difluoro-4-oxo-1-piperidinecarboxylate |
| 1,1-Dimethylethyl 3,3-difluoro-4-oxo-1-piperidinecarboxylate |
| tert-Butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate |
| PS-J-082 |
| T6N DVTJ AVOX1&1&1 CF CF |
| 1-Piperidinecarboxylic acid, 3,3-difluoro-4-oxo-, 1,1-dimethylethyl ester |
| tert-butyl3,3-difluoro-4-oxopiperidine-1-carboxylate |
| 1-tert-butyloxycarbonyl-3,3-difluoro-4-oxopiperidine |