(3-CHLOROPROPYL)DIETHOXYMETHYLSILANE structure
|
Common Name | (3-CHLOROPROPYL)DIETHOXYMETHYLSILANE | ||
|---|---|---|---|---|
| CAS Number | 121512-59-2 | Molecular Weight | 357.81400 | |
| Density | 1.423g/cm3 | Boiling Point | 562ºC at 760mmHg | |
| Molecular Formula | C17H12ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.7ºC | |
| Name | 2-(3-chloroquinoxalin-2-yl)-2-(4-methylphenyl)sulfonylacetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 562ºC at 760mmHg |
| Molecular Formula | C17H12ClN3O2S |
| Molecular Weight | 357.81400 |
| Flash Point | 293.7ºC |
| Exact Mass | 357.03400 |
| PSA | 92.09000 |
| LogP | 4.71098 |
| Vapour Pressure | 1.17E-12mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | OKSFNMZZGILCOI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C(C#N)c2nc3ccccc3nc2Cl)cc1 |
|
~%
(3-CHLOROPROPYL... CAS#:121512-59-2 |
| Literature: REGENTS OF THE UNIVERSITY OF MINNESOTA; CHO, Yong-yeon; DONG, Zigang; BODE, Ann, M.; KIM, Dong, Joon; KIM, Myoung, Ok; REDDY, Kanamata, Srinivasa Patent: WO2013/138341 A1, 2013 ; Location in patent: Page/Page column 49 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| (3-Chloro-quinoxalin-2-yl)-(toluene-4-sulfonyl)-acetonitrile |
| 2-Quinoxalineacetonitrile,3-chloro-a-[(4-methylphenyl)sulfonyl] |