2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide
Modify Date: 2025-09-27 22:32:52
2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide structure
|
Common Name | 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 1215744-05-0 | Molecular Weight | 284.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14BrNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14BrNS |
|---|---|
| Molecular Weight | 284.22 |
| InChIKey | VYGIWORLYAOWPT-UHFFFAOYSA-N |
| SMILES | Br.Cc1ccc(-c2nc(C)sc2C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide? |
| A: Molecular weight of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide is 284.22. |
| Q: What is the SMILES notation of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide? |
| A: SMILES notation of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide is Br.Cc1ccc(-c2nc(C)sc2C)cc1. |
| Q: What is the Chinese name of 1215744-05-0? |
| A: Chinese name of 1215744-05-0 is 1215744-05-0. |
| Q: What is the English name of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide? |
| A: The English name of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide is 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide. |
| Q: What is the InChIKey of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide? |
| A: InChIKey of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide is VYGIWORLYAOWPT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide? |
| A: Molecular formula of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide is C12H14BrNS. |
| Q: What is the CAS number of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide? |
| A: CAS number of 2,5-Dimethyl-4-(p-tolyl)thiazole hydrobromide is 1215744-05-0. |