5-(2-bromoprop-2-enyl)-5-pentan-2-yl-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-(2-bromoprop-2-enyl)-5-pentan-2-yl-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 1216-40-6 | Molecular Weight | 317.17900 | |
| Density | 1.357g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H17BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-bromoprop-2-enyl)-5-pentan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Molecular Formula | C12H17BrN2O3 |
| Molecular Weight | 317.17900 |
| Exact Mass | 316.04200 |
| PSA | 82.25000 |
| LogP | 2.62550 |
| Index of Refraction | 1.509 |
| InChIKey | ZGVCLZRQOUEZHG-UHFFFAOYSA-N |
| SMILES | C=C(Br)CC1(C(C)CCC)C(=O)NC(=O)NC1=O |
| HS Code | 2933540000 |
|---|
|
~%
5-(2-bromoprop-... CAS#:1216-40-6 |
| Literature: DE575470 , ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 18, p. 2887 US1739662 , ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-(2-Brom-allyl)-5-(1-methyl-butyl)-barbitursaeure |
| 5-(2-bromo-allyl)-5-(1-methyl-butyl)-pyrimidine-2,4,6-trione |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(2-bromo-2-propenyl)-5-sec-pentyl-(9CI) |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(2-bromo-2-propenyl)-5-(1-methylbutyl) |
| (2-Brom-allyl)-(1-methyl-butyl)-barbitursaeure |
| 5-(2-Bromoallyl)-5-(1-methylbutyl)-1H,3H,5H-pyrimidine-2,4,6-trione |
| EINECS 214-932-2 |
| 5-(2-bromo-allyl)-5-(1-methyl-butyl)-barbituric acid |