3,4-Dihydro Naratriptan structure
|
Common Name | 3,4-Dihydro Naratriptan | ||
|---|---|---|---|---|
| CAS Number | 121679-20-7 | Molecular Weight | 333.45 | |
| Density | 1.26g/cm3 | Boiling Point | 557.486ºC at 760 mmHg | |
| Molecular Formula | C17H23N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.957ºC | |
Use of 3,4-Dihydro Naratriptan3,4-Dihydro Naratriptan is a serotonin 5-HT1-receptor agonist. 3,4-Dihydro Naratriptan exhibits selective vasoconstrictor activity. 3,4-Dihydro Naratriptan can be used for migraine diseases research[1]. |
| Name | N-methyl-2-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl]ethanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | 3,4-Dihydro Naratriptan is a serotonin 5-HT1-receptor agonist. 3,4-Dihydro Naratriptan exhibits selective vasoconstrictor activity. 3,4-Dihydro Naratriptan can be used for migraine diseases research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 557.486ºC at 760 mmHg |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.45 |
| Flash Point | 290.957ºC |
| Exact Mass | 333.15100 |
| PSA | 73.58000 |
| LogP | 3.38810 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | UJPMSESNMYEKDD-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CCc1ccc2[nH]cc(C3=CCN(C)CC3)c2c1 |
|
~92%
3,4-Dihydro Nar... CAS#:121679-20-7 |
| Literature: USV LIMITED Patent: WO2009/118753 A2, 2009 ; Location in patent: Page/Page column 27 ; |
|
~%
3,4-Dihydro Nar... CAS#:121679-20-7 |
| Literature: WO2011/21000 A2, ; |
|
~%
3,4-Dihydro Nar... CAS#:121679-20-7 |
| Literature: WO2011/21000 A2, ; |
|
~%
3,4-Dihydro Nar... CAS#:121679-20-7 |
| Literature: WO2011/21000 A2, ; |
|
~%
3,4-Dihydro Nar... CAS#:121679-20-7 |
| Literature: WO2011/21000 A2, ; |
|
~%
3,4-Dihydro Nar... CAS#:121679-20-7 |
| Literature: WO2011/21000 A2, ; |
| 3,4-Didehydronaratriptan |
| USP naratriptan related compound B free base |
| Naratriptan Impurity B |
| UNII-YCR9MR124U |