Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate
Modify Date: 2026-08-14 19:02:05
![Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate Structure](https://www.chemsrc.com/extcaspic/027/1216929-71-3.png)
Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate structure
|
Common Name | Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 1216929-71-3 | Molecular Weight | 327.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14FN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14FN3O3 |
|---|---|
| Molecular Weight | 327.31 |
| InChIKey | VCVJJDUQFTWVLJ-UHFFFAOYSA-N |
| SMILES | COC(=O)NCc1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate? |
| A: Molecular weight of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate is 327.31. |
| Q: What is the molecular formula of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate? |
| A: Molecular formula of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate is C17H14FN3O3. |
| Q: What is the English name of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate? |
| A: The English name of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate is Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate. |
| Q: What is the CAS number of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate? |
| A: CAS number of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate is 1216929-71-3. |
| Q: What is the SMILES notation of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate? |
| A: SMILES notation of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate is COC(=O)NCc1nc2ccccc2c(=O)n1-c1ccc(F)cc1. |
| Q: What is the InChIKey of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate? |
| A: InChIKey of Methyl N-[[3-(4-fluorophenyl)-3,4-dihydro-4-oxo-2-quinazolinyl]methyl]carbamate is VCVJJDUQFTWVLJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1216929-71-3? |
| A: Chinese name of 1216929-71-3 is 1216929-71-3. |