Thiophosphoric acid O-[2-chloro-1-(2,4-dibromophenyl)ethenyl]O,O-dimethyl ester structure
|
Common Name | Thiophosphoric acid O-[2-chloro-1-(2,4-dibromophenyl)ethenyl]O,O-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1217-96-5 | Molecular Weight | 436.48400 | |
| Density | 1.78g/cm3 | Boiling Point | 406.9ºC at 760 mmHg | |
| Molecular Formula | C10H10Br2ClO3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.9ºC | |
| Name | [(E)-2-chloro-1-(2,4-dibromophenyl)ethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.78g/cm3 |
|---|---|
| Boiling Point | 406.9ºC at 760 mmHg |
| Molecular Formula | C10H10Br2ClO3PS |
| Molecular Weight | 436.48400 |
| Flash Point | 199.9ºC |
| Exact Mass | 433.81400 |
| PSA | 69.59000 |
| LogP | 5.93330 |
| Vapour Pressure | 1.85E-06mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | LZRJENBJTBVXQR-UXBLZVDNSA-N |
| SMILES | COP(=S)(OC)OC(=CCl)c1ccc(Br)cc1Br |
| HS Code | 2920190090 |
|---|
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ENT 27,120 |
| SD 9174 |
| O-(2-Chloro-1-(2,4-dibromophenyl)ethenyl) O,O-dimethyl phosphorodithioate |
| Shell SD-9174 |
| Phosphorothioic acid,O-(2-chloro-1-(2,4-dibromophenyl)ethenyl) O,O-dimethyl ester |
| [(E)-2-chloro-1-(2,4-dibromophenyl)ethenoxy]-dimethoxy-sulfanylidene |
| Phosphorothioic acid,O-(2-chloro-(2,4-dibromophenyl)vinyl) O,O-dimethyl ester |