Thiophosphoric acid O-[1-(4-bromo-2-chlorophenyl)-2-chlorovinyl]O,O-dimethyl ester structure
|
Common Name | Thiophosphoric acid O-[1-(4-bromo-2-chlorophenyl)-2-chlorovinyl]O,O-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1217-97-6 | Molecular Weight | 392.03300 | |
| Density | 1.627g/cm3 | Boiling Point | 398.8ºC at 760 mmHg | |
| Molecular Formula | C10H10BrCl2O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195ºC | |
| Name | [(E)-1-(3-bromo-2-chlorophenyl)-2-chloroethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.627g/cm3 |
|---|---|
| Boiling Point | 398.8ºC at 760 mmHg |
| Molecular Formula | C10H10BrCl2O3PS |
| Molecular Weight | 392.03300 |
| Flash Point | 195ºC |
| Exact Mass | 389.86500 |
| PSA | 69.59000 |
| LogP | 5.82420 |
| Vapour Pressure | 3.3E-06mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | UZTAYVUMQTVBBD-RMKNXTFCSA-N |
| SMILES | COP(=S)(OC)OC(=CCl)c1cccc(Br)c1Cl |
| HS Code | 2920190090 |
|---|
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ENT 27,121 |
| Phosphorothioic acid,O-(1-(4-bromo-2-chlorophenyl)-2-chlorovinyl) O,O-dimethyl ester |
| Phosphorothioic acid,O-(1-(4-bromo-2-chlorophenyl)-2-chloroethenyl) O,O-dimethyl ester |
| SD 9320 |
| [(E)-1-(3-bromo-2-chlorophenyl)-2-chloroethenoxy]-dimethoxy-sulfanylidene |
| O-(1-(4-Bromo-2-chlorophenyl)-2-chloroethenyl) O,O-dimethyl phosphorothioate |
| Shell SD-9320 |