N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide
Modify Date: 2025-09-09 17:51:50
![N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide Structure](https://www.chemsrc.com/extcaspic/117/1217035-59-0.png)
N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide structure
|
Common Name | N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide | ||
|---|---|---|---|---|
| CAS Number | 1217035-59-0 | Molecular Weight | 398.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H30N2O4 |
|---|---|
| Molecular Weight | 398.5 |
| InChIKey | PBMLYPNYTJRGMO-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CNC(=O)COc2ccccc2)N2CCCCC2)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide? |
| A: CAS number of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide is 1217035-59-0. |
| Q: What is the English name of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide? |
| A: The English name of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide is N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide. |
| Q: What is the SMILES notation of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide? |
| A: SMILES notation of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide is COc1ccc(C(CNC(=O)COc2ccccc2)N2CCCCC2)cc1OC. |
| Q: What is the Chinese name of 1217035-59-0? |
| A: Chinese name of 1217035-59-0 is 1217035-59-0. |
| Q: What is the molecular formula of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide? |
| A: Molecular formula of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide is C23H30N2O4. |
| Q: What is the molecular weight of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide? |
| A: Molecular weight of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide is 398.5. |
| Q: What is the InChIKey of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide? |
| A: InChIKey of N-[2-(3,4-Dimethoxyphenyl)-2-(1-piperidinyl)ethyl]-2-phenoxyacetamide is PBMLYPNYTJRGMO-UHFFFAOYSA-N. |