[3,4,6-tritert-butyl-2-(hydroxymethyl)phenyl]methanol structure
|
Common Name | [3,4,6-tritert-butyl-2-(hydroxymethyl)phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 121724-81-0 | Molecular Weight | 306.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3,4,6-tritert-butyl-2-(hydroxymethyl)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H34O2 |
|---|---|
| Molecular Weight | 306.48300 |
| Exact Mass | 306.25600 |
| PSA | 40.46000 |
| LogP | 4.56370 |
| InChIKey | QZJWJFKAVWICNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(C(C)(C)C)c(CO)c1CO |
|
~85%
[3,4,6-tritert-... CAS#:121724-81-0 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 65, # 3 p. 932 - 934 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 3,4,6-tri-t-butyl-1,2-benzenedimethanol |
| 1,2-Benzenedimethanol,3,4,6-tris(1,1-dimethylethyl) |