Vitronectin (367-378)
Modify Date: 2025-08-30 11:34:48
Vitronectin (367-378) structure
|
Common Name | Vitronectin (367-378) | ||
|---|---|---|---|---|
| CAS Number | 1217344-74-5 | Molecular Weight | 1667.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C70H122N32O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Vitronectin (367-378)Vitronectin (367-378) is a peptide corresponding to residues 367-378 of Vitronectin. Vitronectin is a multifunctional glycoprotein known in several human tumors for its adhesive role in processes such as cell growth, angiogenesis and metastasis[1]. |
| Name | Vitronectin (367-378) |
|---|
| Description | Vitronectin (367-378) is a peptide corresponding to residues 367-378 of Vitronectin. Vitronectin is a multifunctional glycoprotein known in several human tumors for its adhesive role in processes such as cell growth, angiogenesis and metastasis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C70H122N32O16 |
|---|---|
| Molecular Weight | 1667.92 |
| InChIKey | SAXSNZNBEWVSJE-LFOOZZFTSA-N |
| SMILES | N=C(N)NCCCC(NC(=O)C(CC(N)=O)NC(=O)C(CCCNC(=N)N)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(CCCNC(=N)N)NC(=O)C(Cc1ccccc1)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCC(N)=O)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)CN)C(=O)NC(CCCCN)C(=O)NCC(=O)O |