[13C3D4]-N-Boc-L-Alanine
Modify Date: 2025-08-20 13:46:05
![[13C3D4]-N-Boc-L-Alanine Structure](https://www.chemsrc.com/extcaspic/091/1217445-26-5.png)
[13C3D4]-N-Boc-L-Alanine structure
|
Common Name | [13C3D4]-N-Boc-L-Alanine | ||
|---|---|---|---|---|
| CAS Number | 1217445-26-5 | Molecular Weight | 196.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [13C3D4]-N-Boc-L-Alanine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H15NO4 |
|---|---|
| Molecular Weight | 196.21 |
| InChIKey | QVHJQCGUWFKTSE-KFGGSPPGSA-N |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [13C3D4]-N-Boc-L-Alanine? |
| A: The English name of [13C3D4]-N-Boc-L-Alanine is [13C3D4]-N-Boc-L-Alanine. |
| Q: What is the InChIKey of [13C3D4]-N-Boc-L-Alanine? |
| A: InChIKey of [13C3D4]-N-Boc-L-Alanine is QVHJQCGUWFKTSE-KFGGSPPGSA-N. |
| Q: What is the CAS number of [13C3D4]-N-Boc-L-Alanine? |
| A: CAS number of [13C3D4]-N-Boc-L-Alanine is 1217445-26-5. |
| Q: What is the SMILES notation of [13C3D4]-N-Boc-L-Alanine? |
| A: SMILES notation of [13C3D4]-N-Boc-L-Alanine is CC(NC(=O)OC(C)(C)C)C(=O)O. |
| Q: What is the Chinese name of 1217445-26-5? |
| A: Chinese name of 1217445-26-5 is 1217445-26-5. |
| Q: What is the molecular weight of [13C3D4]-N-Boc-L-Alanine? |
| A: Molecular weight of [13C3D4]-N-Boc-L-Alanine is 196.21. |
| Q: What is the molecular formula of [13C3D4]-N-Boc-L-Alanine? |
| A: Molecular formula of [13C3D4]-N-Boc-L-Alanine is C8H15NO4. |