(2R,3R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoic acid structure
|
Common Name | (2R,3R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1217456-02-4 | Molecular Weight | 279.332 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 428.9±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 213.2±26.8 °C | |
| Name | (2R,3R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.9±38.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.332 |
| Flash Point | 213.2±26.8 °C |
| Exact Mass | 279.147064 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | RPHRJSPXJCPPIP-ZYHUDNBSSA-N |
| SMILES | CC(C(=O)O)C(NC(=O)OC(C)(C)C)c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| (2R,3R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoic acid |
| Benzenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-, (αR,βR)- |