Biotin-PEG4-alcohol structure
|
Common Name | Biotin-PEG4-alcohol | ||
|---|---|---|---|---|
| CAS Number | 1217609-84-1 | Molecular Weight | 419.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H33N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG4-alcoholBiotin-PEG4-OH is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. |
| Name | Biotin-PEG4-OH |
|---|
| Description | Biotin-PEG4-OH is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Molecular Formula | C18H33N3O6S |
|---|---|
| Molecular Weight | 419.54 |
| InChIKey | ZXIIDTTUJDVFCP-BFYDXBDKSA-N |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCOCCO |