N1-(2-methoxyethyl)-L-leucinamide
Modify Date: 2026-06-29 22:04:32
N1-(2-methoxyethyl)-L-leucinamide structure
|
Common Name | N1-(2-methoxyethyl)-L-leucinamide | ||
|---|---|---|---|---|
| CAS Number | 1217618-94-4 | Molecular Weight | 188.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-(2-methoxyethyl)-L-leucinamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H20N2O2 |
|---|---|
| Molecular Weight | 188.27 |
| InChIKey | CWXFLZLSSFQJFN-QMMMGPOBSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCCOC)N |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Phenotypic growth assay for Mycobacterium tuberculosis grown for 4 days on DPPC, chol...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4649948
|
|
Name: Phenotypic growth assay for Mycobacterium tuberculosis grown for 3 days on 7H9, gluco...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4649949
|
|
Name: Antibacterial activity against Acinetobacter baumannii ATCC 19606 (CO-ADD:GN_034); MI...
Source: ChEMBL
Target: Acinetobacter baumannii
External Id: CHEMBL4296188
|
|
Name: Antibacterial activity against Pseudomonas aeruginosa ATCC 27853 (CO-ADD:GN_042); MIC...
Source: ChEMBL
Target: Pseudomonas aeruginosa
External Id: CHEMBL4296187
|
|
Name: Antibacterial activity against Pseudomonas aeruginosa PAO397 [PAO1 d(mexAB-oprM) d(me...
Source: ChEMBL
Target: Pseudomonas aeruginosa
External Id: CHEMBL4296802
|
Total 5, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N1-(2-methoxyethyl)-L-leucinamide? |
| A: Molecular weight of N1-(2-methoxyethyl)-L-leucinamide is 188.27. |
| Q: What is the CAS number of N1-(2-methoxyethyl)-L-leucinamide? |
| A: CAS number of N1-(2-methoxyethyl)-L-leucinamide is 1217618-94-4. |
| Q: What is the InChIKey of N1-(2-methoxyethyl)-L-leucinamide? |
| A: InChIKey of N1-(2-methoxyethyl)-L-leucinamide is CWXFLZLSSFQJFN-QMMMGPOBSA-N. |
| Q: What is the English name of N1-(2-methoxyethyl)-L-leucinamide? |
| A: The English name of N1-(2-methoxyethyl)-L-leucinamide is N1-(2-methoxyethyl)-L-leucinamide. |
| Q: What is the Chinese name of 1217618-94-4? |
| A: Chinese name of 1217618-94-4 is 1217618-94-4. |
| Q: What is the SMILES notation of N1-(2-methoxyethyl)-L-leucinamide? |
| A: SMILES notation of N1-(2-methoxyethyl)-L-leucinamide is CC(C)C[C@@H](C(=O)NCCOC)N. |
| Q: What is the molecular formula of N1-(2-methoxyethyl)-L-leucinamide? |
| A: Molecular formula of N1-(2-methoxyethyl)-L-leucinamide is C9H20N2O2. |