7-Ethyl-d3-camptothecin structure
|
Common Name | 7-Ethyl-d3-camptothecin | ||
|---|---|---|---|---|
| CAS Number | 1217626-02-2 | Molecular Weight | 379.42 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 752.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C22H17D3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 409.1±32.9 °C | |
| Name | 7-Ethyl-d3-camptothecin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 752.9±60.0 °C at 760 mmHg |
| Molecular Formula | C22H17D3N2O4 |
| Molecular Weight | 379.42 |
| Flash Point | 409.1±32.9 °C |
| Exact Mass | 379.161133 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.713 |
| InChIKey | MYQKIWCVEPUPIL-MVTYLIICSA-N |
| SMILES | CCc1c2c(nc3ccccc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(O)CC |
| Water Solubility | Soluble in N,N-Dimethylformamide and Dimethyl Sulfoxide |
| (4S)-4-Ethyl-11-[(2,2,2-2H3)ethyl]-4-hydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
| 1H-Pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 4-ethyl-11-(ethyl-2,2,2-d3)-4-hydroxy-, (4S)- |
| (4S)-4,11-Diethyl-4-hydroxy-1H-pyrano[3′,4′:6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione-d3 |
| 7-Ethyl-d3-20(S)-camptothecin |