phenyl-[4-(trichloromethyl)phenyl]methanone structure
|
Common Name | phenyl-[4-(trichloromethyl)phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 1218-90-2 | Molecular Weight | 299.58000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl-[4-(trichloromethyl)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9Cl3O |
|---|---|
| Molecular Weight | 299.58000 |
| Exact Mass | 297.97200 |
| PSA | 17.07000 |
| LogP | 4.74430 |
| InChIKey | BASGHVRDJXCOQO-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(C(Cl)(Cl)Cl)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
phenyl-[4-(tric... CAS#:1218-90-2 |
| Literature: Thoerner Justus Liebigs Annalen der Chemie, 1877 , vol. 189, p. 84 |
|
~%
phenyl-[4-(tric... CAS#:1218-90-2 |
| Literature: Thoerner Justus Liebigs Annalen der Chemie, 1877 , vol. 189, p. 84 |
|
~%
phenyl-[4-(tric... CAS#:1218-90-2 |
| Literature: Thoerner Justus Liebigs Annalen der Chemie, 1877 , vol. 189, p. 84 |
|
~%
phenyl-[4-(tric... CAS#:1218-90-2 |
| Literature: Thoerner Justus Liebigs Annalen der Chemie, 1877 , vol. 189, p. 84 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Trichlormethyl-benzophenon |
| 4-(trichloromethyl)-benzophenone |
| Methanone,phenyl[4-(trichloromethyl)phenyl] |
| p-Benzoyl-benzotrichlorid |
| Phenyl-(4-trichlormethyl-phenyl)-keton |