3-(4-fluorophenyl)-5,7-dimethylpyrido[3,4-e][1,2,4]triazine structure
|
Common Name | 3-(4-fluorophenyl)-5,7-dimethylpyrido[3,4-e][1,2,4]triazine | ||
|---|---|---|---|---|
| CAS Number | 121845-78-1 | Molecular Weight | 254.26200 | |
| Density | 1.28g/cm3 | Boiling Point | 425.4ºC at 760 mmHg | |
| Molecular Formula | C14H11FN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | 3-(4-fluorophenyl)-5,7-dimethylpyrido[3,4-e][1,2,4]triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 425.4ºC at 760 mmHg |
| Molecular Formula | C14H11FN4 |
| Molecular Weight | 254.26200 |
| Flash Point | 211.1ºC |
| Exact Mass | 254.09700 |
| PSA | 51.56000 |
| LogP | 2.84270 |
| Vapour Pressure | 4.77E-07mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | CCDSSJHYLBLXRY-UHFFFAOYSA-N |
| SMILES | Cc1cc2nnc(-c3ccc(F)cc3)nc2c(C)n1 |
|
~%
3-(4-fluorophen... CAS#:121845-78-1 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
|
~%
3-(4-fluorophen... CAS#:121845-78-1 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Pyrido[3,4-e]-1,2,4-triazine,3-(4-fluorophenyl)-5,7-dimethyl |
| 3-(4-Fluoro-phenyl)-5,7-dimethyl-pyrido(3,4-e)(1,2,4)triazine |