3-(4-fluorophenyl)-5,7-dimethylpyrido[3,4-e][1,2,4]triazin-8-amine structure
|
Common Name | 3-(4-fluorophenyl)-5,7-dimethylpyrido[3,4-e][1,2,4]triazin-8-amine | ||
|---|---|---|---|---|
| CAS Number | 121845-81-6 | Molecular Weight | 269.27700 | |
| Density | 1.341g/cm3 | Boiling Point | 498.9ºC at 760 mmHg | |
| Molecular Formula | C14H12FN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.5ºC | |
| Name | 3-(4-fluorophenyl)-5,7-dimethylpyrido[3,4-e][1,2,4]triazin-8-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 498.9ºC at 760 mmHg |
| Molecular Formula | C14H12FN5 |
| Molecular Weight | 269.27700 |
| Flash Point | 255.5ºC |
| Exact Mass | 269.10800 |
| PSA | 77.58000 |
| LogP | 3.00610 |
| Vapour Pressure | 4.34E-10mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | JAOCVEUXLCGBQW-UHFFFAOYSA-N |
| SMILES | Cc1nc(C)c2nc(-c3ccc(F)cc3)nnc2c1N |
|
~%
3-(4-fluorophen... CAS#:121845-81-6 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
|
~%
3-(4-fluorophen... CAS#:121845-81-6 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
| 3-(4-Fluoro-phenyl)-5,7-dimethyl-pyrido(3,4-e)(1,2,4)triazin-8-ylamine |
| Pyrido[3,4-e]-1,2,4-triazin-8-amine,3-(4-fluorophenyl)-5,7-dimethyl |