(3,5-dimethylpiperidin-1-yl)-phenylmethanone structure
|
Common Name | (3,5-dimethylpiperidin-1-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 121882-68-6 | Molecular Weight | 217.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,5-dimethylpiperidin-1-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO |
|---|---|
| Molecular Weight | 217.30700 |
| Exact Mass | 217.14700 |
| PSA | 20.31000 |
| LogP | 2.74260 |
| InChIKey | ZIYABAITZZCZFQ-UHFFFAOYSA-N |
| SMILES | CC1CC(C)CN(C(=O)c2ccccc2)C1 |
|
~95%
(3,5-dimethylpi... CAS#:121882-68-6 |
| Literature: Ishihara, Kazuaki; Ohara, Suguru; Yamamoto, Hisashi Journal of Organic Chemistry, 1996 , vol. 61, # 13 p. 4196 - 4197 |
|
~%
(3,5-dimethylpi... CAS#:121882-68-6 |
| Literature: Nguyen, Binh T.; Cartledge, Frank K. Journal of Organic Chemistry, 1986 , vol. 51, # 12 p. 2206 - 2210 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-benzoyl-3,5-dimethylpiperidine |
| Piperidine,1-benzoyl-3,5-dimethyl |