3-(2-hydroxyethyl)-6-nitro-1,3-benzothiazol-2-one structure
|
Common Name | 3-(2-hydroxyethyl)-6-nitro-1,3-benzothiazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 121899-66-9 | Molecular Weight | 240.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-hydroxyethyl)-6-nitro-1,3-benzothiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8N2O4S |
|---|---|
| Molecular Weight | 240.23600 |
| Exact Mass | 240.02000 |
| PSA | 116.29000 |
| LogP | 1.48670 |
| InChIKey | MWEVBWFZLWVZQJ-UHFFFAOYSA-N |
| SMILES | O=c1sc2cc([N+](=O)[O-])ccc2n1CCO |
|
~91%
3-(2-hydroxyeth... CAS#:121899-66-9 |
| Literature: D'Amico, John J.; Bollinger, Frederic G. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 1601 - 1605 |
|
~15%
3-(2-hydroxyeth... CAS#:121899-66-9 |
| Literature: Ambartsumova; Tashkhodzhaev; Antipin; Shakhidoyatov Chemistry of Heterocyclic Compounds, 2002 , vol. 38, # 11 p. 1397 - 1405 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2(3H)-Benzothiazolone,3-(2-hydroxyethyl)-6-nitro |