1,3-bis-(4-Chlorophenyl)urea structure
|
Common Name | 1,3-bis-(4-Chlorophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 1219-99-4 | Molecular Weight | 281.13700 | |
| Density | 1.45 g/cm3 | Boiling Point | 318.3ºC at 760mmHg | |
| Molecular Formula | C13H10Cl2N2O | Melting Point | 306 °C | |
| MSDS | N/A | Flash Point | 146.3ºC | |
| Name | 1,3-bis(4-chlorophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45 g/cm3 |
|---|---|
| Boiling Point | 318.3ºC at 760mmHg |
| Melting Point | 306 °C |
| Molecular Formula | C13H10Cl2N2O |
| Molecular Weight | 281.13700 |
| Flash Point | 146.3ºC |
| Exact Mass | 280.01700 |
| PSA | 41.13000 |
| LogP | 4.78340 |
| Vapour Pressure | 0.000364mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | ZNQCSLYENQIUMJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(Cl)cc1 |
| RIDADR | UN 3077 9 / PGIII |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n,n'-di(4-chlorophenyl)urea |
| Urea,N,N'-bis(4-chlorophenyl) |
| Urea-based compound,9 |
| 4,4'-Dichlorocarbanilide |
| N,N'-di(p-chlorophenyl)urea |
| N,N'-bis-(4-chlorophenyl)urea |
| N-(4-chlorophenyl)[(4-chlorophenyl)amino]carboxamide |
| 1,3-di-p-chlorophenylcarbamide |