Boc-7-methyl-DL-tryptophan structure
|
Common Name | Boc-7-methyl-DL-tryptophan | ||
|---|---|---|---|---|
| CAS Number | 1219333-83-1 | Molecular Weight | 318.368 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 540.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.5±30.1 °C | |
| Name | Boc-7-methyl-DL-tryptophan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 540.2±50.0 °C at 760 mmHg |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.368 |
| Flash Point | 280.5±30.1 °C |
| Exact Mass | 318.157959 |
| PSA | 91.42000 |
| LogP | 3.35 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | JCBJFQWNCYKIEX-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c(CC(NC(=O)OC(C)(C)C)C(=O)O)c[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Tryptophan, N-[(1,1-dimethylethoxy)carbonyl]-7-methyl- |
| 7-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}tryptophan |