1'-O-Acetylpaxilline structure
|
Common Name | 1'-O-Acetylpaxilline | ||
|---|---|---|---|---|
| CAS Number | 121998-08-1 | Molecular Weight | 477.59200 | |
| Density | 1.29g/cm3 | Boiling Point | 653.8ºC at 760mmHg | |
| Molecular Formula | C29H35NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.2ºC | |
| Name | 1'-O-Acetylpaxilline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 653.8ºC at 760mmHg |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.59200 |
| Flash Point | 349.2ºC |
| Exact Mass | 477.25200 |
| PSA | 88.62000 |
| LogP | 4.52750 |
| Vapour Pressure | 5.54E-18mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | OHPVFSRTGKOAHP-FPCGACKZSA-N |
| SMILES | CC(=O)OC(C)(C)C1OC2CCC3(C)C(O)(CCC4Cc5c([nH]c6ccccc56)C43C)C2=CC1=O |
|
~%
1'-O-Acetylpaxilline CAS#:121998-08-1 |
| Literature: Nozawa; Horie; Udagawa; Kawai; Yamazaki Chemical and pharmaceutical bulletin, 1989 , vol. 37, # 5 p. 1387 - 1389 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2H-1-Benzopyrano(5',6':6,7)indeno(1,2-b)indol-3(4bH)-one,2-(1-(acetyloxy)-1-methylethyl)-5,6,6a,7,12,12b,12c,13,14,14a-decahydro-4b-hydroxy-12b,12c-dimethyl-,(2R-(2alpha,4bbeta,6aalpha,12bbeta,12calpha,14abeta)) |