Ethanone,1-(5,5-dioxido-10H-phenothiazin-10-yl)- structure
|
Common Name | Ethanone,1-(5,5-dioxido-10H-phenothiazin-10-yl)- | ||
|---|---|---|---|---|
| CAS Number | 1220-99-1 | Molecular Weight | 273.30700 | |
| Density | 1.401g/cm3 | Boiling Point | 569.5ºC at 760 mmHg | |
| Molecular Formula | C14H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.2ºC | |
| Name | 1-(5,5-dioxophenothiazin-10-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 569.5ºC at 760 mmHg |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.30700 |
| Flash Point | 298.2ºC |
| Exact Mass | 273.04600 |
| PSA | 62.83000 |
| LogP | 3.66320 |
| Vapour Pressure | 5.51E-13mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | UNVGDZPNNRQUNC-UHFFFAOYSA-N |
| SMILES | CC(=O)N1c2ccccc2S(=O)(=O)c2ccccc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Acetylphenothiazine S,S-dioxide |
| 10-Acetyl-phenothiazin-5,5-dioxid |
| 10-acetyl-phenothiazine-5,5-dioxide |
| 1-(5,5-dioxido-10H-phenothiazin-10-yl)ethanone |
| 9-Acetyl-phenothiazin-10-dioxid |
| N-acetylphenothiazine 5,5-dioxide |
| 10-acetyl-10H-phenothiazine 5,5-dioxide |
| HMS2201I17 |