Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl
Modify Date: 2026-07-03 12:11:52
![Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl Structure](https://www.chemsrc.com/extcaspic/258/122002-76-0.png)
Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl structure
|
Common Name | Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 122002-76-0 | Molecular Weight | 368.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H32N4O |
|---|---|
| Molecular Weight | 368.5 |
| InChIKey | FASPQJKFUXVFTB-UHFFFAOYSA-N |
| SMILES | CCNc1cccnc1N1CCN(CCCc2cc(C)c(O)c(C)c2)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl? |
| A: CAS number of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl is 122002-76-0. |
| Q: What is the Chinese name of 122002-76-0? |
| A: Chinese name of 122002-76-0 is 122002-76-0. |
| Q: What is the English name of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl? |
| A: The English name of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl is Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl. |
| Q: What is the SMILES notation of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl? |
| A: SMILES notation of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl is CCNc1cccnc1N1CCN(CCCc2cc(C)c(O)c(C)c2)CC1. |
| Q: What is the molecular weight of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl? |
| A: Molecular weight of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl is 368.5. |
| Q: What is the molecular formula of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl? |
| A: Molecular formula of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl is C22H32N4O. |
| Q: What is the InChIKey of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl? |
| A: InChIKey of Phenol, 4-[3-[4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl]propyl]-2,6-dimethyl is FASPQJKFUXVFTB-UHFFFAOYSA-N. |