4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride
Modify Date: 2025-09-11 21:02:45
4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride structure
|
Common Name | 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1220032-08-5 | Molecular Weight | 262.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17Cl2NO |
|---|---|
| Molecular Weight | 262.17 |
| InChIKey | FXNMVBXQWGFBQC-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCC2CCNC2)ccc1Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride? |
| A: Molecular weight of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride is 262.17. |
| Q: What is the SMILES notation of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride? |
| A: SMILES notation of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride is Cc1cc(OCC2CCNC2)ccc1Cl.Cl. |
| Q: What is the CAS number of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride? |
| A: CAS number of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride is 1220032-08-5. |
| Q: What is the InChIKey of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride? |
| A: InChIKey of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride is FXNMVBXQWGFBQC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride? |
| A: Molecular formula of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride is C12H17Cl2NO. |
| Q: What is the English name of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride? |
| A: The English name of 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride is 4-Chloro-3-methylphenyl 3-pyrrolidinylmethyl ether hydrochloride. |
| Q: What is the Chinese name of 1220032-08-5? |
| A: Chinese name of 1220032-08-5 is 1220032-08-5. |