3-[[N-(3-Amino-2,4,6-triiodophenyl)-N-methylamino]carbonyl]propionic acid structure
|
Common Name | 3-[[N-(3-Amino-2,4,6-triiodophenyl)-N-methylamino]carbonyl]propionic acid | ||
|---|---|---|---|---|
| CAS Number | 1221-05-2 | Molecular Weight | 599.93000 | |
| Density | 2.529g/cm3 | Boiling Point | 663.8ºC at 760 mmHg | |
| Molecular Formula | C11H11I3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.3ºC | |
| Name | 4-(3-amino-2,4,6-triiodo-N-methylanilino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.529g/cm3 |
|---|---|
| Boiling Point | 663.8ºC at 760 mmHg |
| Molecular Formula | C11H11I3N2O3 |
| Molecular Weight | 599.93000 |
| Flash Point | 355.3ºC |
| Exact Mass | 599.79000 |
| PSA | 83.63000 |
| LogP | 3.49140 |
| Vapour Pressure | 1.59E-18mmHg at 25°C |
| Index of Refraction | 1.774 |
| InChIKey | LTJAWEPNFDGFQG-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CCC(=O)O)c1c(I)cc(I)c(N)c1I |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Methyl-N-(2,4,6-trijod-3-aminophenyl)-succinamidsaeure [German] |
| N-Methyl-N-(2,4,6-trijod-3-aminophenyl)-succinamidsaeure |
| Butanoic acid,4-((3-amino-2,4,6-triiodophenyl)methylamino)-4-oxo-(9CI) |
| 3'-Amino-N-methyl-2',4',6'-triiodosuccinanilic acid |
| Succinanilic acid,3'-amino-N-methyl-2',4',6'-triiodo |
| Butanoic acid,4-((3-amino-2,4,6-triiodophenyl)methylamino)-4-oxo |