Ethyl 7-(4-methoxyphenyl)-7-oxoheptanoate structure
|
Common Name | Ethyl 7-(4-methoxyphenyl)-7-oxoheptanoate | ||
|---|---|---|---|---|
| CAS Number | 122115-54-2 | Molecular Weight | 278.34300 | |
| Density | 1.054g/cm3 | Boiling Point | 398.146ºC at 760 mmHg | |
| Molecular Formula | C16H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.909ºC | |
| Name | Ethyl 7-(4-methoxyphenyl)-7-oxoheptanoate |
|---|
| Density | 1.054g/cm3 |
|---|---|
| Boiling Point | 398.146ºC at 760 mmHg |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.34300 |
| Flash Point | 173.909ºC |
| Exact Mass | 278.15200 |
| PSA | 52.60000 |
| LogP | 3.39150 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | PHAFJUYPYMREHA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCC(=O)c1ccc(OC)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
Ethyl 7-(4-meth... CAS#:122115-54-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 45, # 13 p. 2877 - 2885 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |