2-(4-FLUOROBENZYL)-3-OXO-BUTYRICACIDMETHYLESTER structure
|
Common Name | 2-(4-FLUOROBENZYL)-3-OXO-BUTYRICACIDMETHYLESTER | ||
|---|---|---|---|---|
| CAS Number | 122255-02-1 | Molecular Weight | 224.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-fluoro-benzyl)-3-oxo-butyric acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13FO3 |
|---|---|
| Molecular Weight | 224.22800 |
| Exact Mass | 224.08500 |
| PSA | 43.37000 |
| LogP | 1.74640 |
| InChIKey | DHTNWKZWQQMWOE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccc(F)cc1)C(C)=O |
| HS Code | 2918300090 |
|---|
|
~72%
2-(4-FLUOROBENZ... CAS#:122255-02-1 |
| Literature: EXELIXIS, INC.; ANAND, Neel, Kumar; BLAZEY, Charles, M.; BOWLES, Owen, Joseph; BUHR, Chris, Allen; BUSSENIUS, Joerg; CURTIS, Jeffry, Kimo; DEFINA, Steven, Charles; DUBENKO, Larisa; HARRIS, Jason, R.; JACKSON-UGUETO, Eileen; JOSHI, Anagha; KIM, Angie, Inyoung; TSUHAKI, Amy, Lew; MA, Sunghoon; MANALO, Jean-claire, Limun; NG, Stephanie; PETO, Csaba, J.; RICE Kenneth D.; TSANG, Tsze, H.; ZAHARIA, Cristiana, A. Patent: WO2010/135524 A1, 2010 ; Location in patent: Page/Page column 202-203 ; WO 2010/135524 A1 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Flufenamic acid,methyl deriv. |
| Flufenamic acid,methyl ester |