Phenaridine, (2alpha,4alpha,5beta)
Modify Date: 2026-07-03 13:10:57
Phenaridine, (2alpha,4alpha,5beta) structure
|
Common Name | Phenaridine, (2alpha,4alpha,5beta) | ||
|---|---|---|---|---|
| CAS Number | 122276-83-9 | Molecular Weight | 364.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenaridine, (2alpha,4alpha,5beta) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H32N2O |
|---|---|
| Molecular Weight | 364.5 |
| InChIKey | ODPKHHGQKIYCTJ-ZRCGQRJVSA-N |
| SMILES | CCC(=O)N(c1ccccc1)C1CC(C)N(CCc2ccccc2)CC1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Phenaridine, (2alpha,4alpha,5beta)? |
| A: The English name of Phenaridine, (2alpha,4alpha,5beta) is Phenaridine, (2alpha,4alpha,5beta). |
| Q: What is the InChIKey of Phenaridine, (2alpha,4alpha,5beta)? |
| A: InChIKey of Phenaridine, (2alpha,4alpha,5beta) is ODPKHHGQKIYCTJ-ZRCGQRJVSA-N. |
| Q: What is the SMILES notation of Phenaridine, (2alpha,4alpha,5beta)? |
| A: SMILES notation of Phenaridine, (2alpha,4alpha,5beta) is CCC(=O)N(c1ccccc1)C1CC(C)N(CCc2ccccc2)CC1C. |
| Q: What is the molecular formula of Phenaridine, (2alpha,4alpha,5beta)? |
| A: Molecular formula of Phenaridine, (2alpha,4alpha,5beta) is C24H32N2O. |
| Q: What is the molecular weight of Phenaridine, (2alpha,4alpha,5beta)? |
| A: Molecular weight of Phenaridine, (2alpha,4alpha,5beta) is 364.5. |
| Q: What is the Chinese name of 122276-83-9? |
| A: Chinese name of 122276-83-9 is 122276-83-9. |
| Q: What is the CAS number of Phenaridine, (2alpha,4alpha,5beta)? |
| A: CAS number of Phenaridine, (2alpha,4alpha,5beta) is 122276-83-9. |